About dipropan-2-yl sulfite
dipropan-2-yl sulfite (PubChem CID 536816) has the molecular formula C6H14O3S
and a molecular weight of 166.24 g/mol. Its IUPAC name is dipropan-2-yl sulfite.
Molecular Properties
| Compound Name | dipropan-2-yl sulfite |
| PubChem CID | 536816 |
| Molecular Formula | C6H14O3S |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | dipropan-2-yl sulfite |
| SMILES | CC(C)OS(=O)OC(C)C |
| InChI | InChI=1S/C6H14O3S/c1-5(2)8-10(7)9-6(3)4/h5-6H,1-4H3 |
| InChIKey | IIKLEMKAKOISSP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dipropan-2-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl sulfite?
The IUPAC name of dipropan-2-yl sulfite (CID 536816) is dipropan-2-yl sulfite.
What is the SMILES notation for dipropan-2-yl sulfite?
The canonical SMILES for dipropan-2-yl sulfite is CC(C)OS(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl sulfite?
The InChIKey is IIKLEMKAKOISSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3S/c1-5(2)8-10(7)9-6(3)4/h5-6H,1-4H3.
What are the key properties of dipropan-2-yl sulfite?
dipropan-2-yl sulfite has a molecular weight of 166.24 g/mol, XLogP of 1.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl sulfite is sourced from PubChem (CID 536816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).