About benzyl (Z)-3-aminobut-2-enoate
benzyl (Z)-3-aminobut-2-enoate (PubChem CID 5368345) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is benzyl (Z)-3-aminobut-2-enoate.
Molecular Properties
| Compound Name | benzyl (Z)-3-aminobut-2-enoate |
| PubChem CID | 5368345 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | benzyl (Z)-3-aminobut-2-enoate |
| SMILES | C/C(N)=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c1-9(12)7-11(13)14-8-10-5-3-2-4-6-10/h2-7H,8,12H2,1H3/b9-7- |
| InChIKey | LPYNWRPARGBJOL-CLFYSBASSA-N |
| XLogP | 1.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl (Z)-3-aminobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (Z)-3-aminobut-2-enoate?
The IUPAC name of benzyl (Z)-3-aminobut-2-enoate (CID 5368345) is benzyl (Z)-3-aminobut-2-enoate.
What is the SMILES notation for benzyl (Z)-3-aminobut-2-enoate?
The canonical SMILES for benzyl (Z)-3-aminobut-2-enoate is C/C(N)=C/C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (Z)-3-aminobut-2-enoate?
The InChIKey is LPYNWRPARGBJOL-CLFYSBASSA-N. The full InChI is InChI=1S/C11H13NO2/c1-9(12)7-11(13)14-8-10-5-3-2-4-6-10/h2-7H,8,12H2,1H3/b9-7-.
What are the key properties of benzyl (Z)-3-aminobut-2-enoate?
benzyl (Z)-3-aminobut-2-enoate has a molecular weight of 191.23 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (Z)-3-aminobut-2-enoate is sourced from PubChem (CID 5368345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).