C12H13NO3 — CID 53684042
(7R)-4-(oxiran-2-ylmethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 53684042) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (7R)-4-(oxiran-2-ylmethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | (7R)-4-(oxiran-2-ylmethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 53684042 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (7R)-4-(oxiran-2-ylmethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | C1[C@@H]2C=CC1C3=C(N(C(=C23)O)CC4CO4)O |
| InChI | InChI=1S/C12H13NO3/c14-11-9-6-1-2-7(3-6)10(9)12(15)13(11)4-8-5-16-8/h1-2,6-8,14-15H,3-5H2/t6-,7?,8?/m0/s1 |
| InChIKey | BIQBNAIFWDNLHS-KKMMWDRVSA-N |
| XLogP | 1.20 |
| TPSA | 57.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 321 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|