About 2-phenyl-1H-1,2,4-triazole-3-thione
2-phenyl-1H-1,2,4-triazole-3-thione (PubChem CID 5368551) has the molecular formula C8H7N3S
and a molecular weight of 177.23 g/mol. Its IUPAC name is 2-phenyl-1H-1,2,4-triazole-3-thione.
Molecular Properties
| Compound Name | 2-phenyl-1H-1,2,4-triazole-3-thione |
| PubChem CID | 5368551 |
| Molecular Formula | C8H7N3S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 2-phenyl-1H-1,2,4-triazole-3-thione |
| SMILES | S=c1nc[nH]n1-c1ccccc1 |
| InChI | InChI=1S/C8H7N3S/c12-8-9-6-10-11(8)7-4-2-1-3-5-7/h1-6H,(H,9,10,12) |
| InChIKey | BVIRJZRMLOIHQT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-1H-1,2,4-triazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1H-1,2,4-triazole-3-thione?
The IUPAC name of 2-phenyl-1H-1,2,4-triazole-3-thione (CID 5368551) is 2-phenyl-1H-1,2,4-triazole-3-thione.
What is the SMILES notation for 2-phenyl-1H-1,2,4-triazole-3-thione?
The canonical SMILES for 2-phenyl-1H-1,2,4-triazole-3-thione is S=c1nc[nH]n1-c1ccccc1.
What is the InChIKey of 2-phenyl-1H-1,2,4-triazole-3-thione?
The InChIKey is BVIRJZRMLOIHQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3S/c12-8-9-6-10-11(8)7-4-2-1-3-5-7/h1-6H,(H,9,10,12).
What are the key properties of 2-phenyl-1H-1,2,4-triazole-3-thione?
2-phenyl-1H-1,2,4-triazole-3-thione has a molecular weight of 177.23 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1H-1,2,4-triazole-3-thione is sourced from PubChem (CID 5368551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).