About N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline
N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline (PubChem CID 5368710) has the molecular formula C13H10Cl2N2
and a molecular weight of 265.14 g/mol. Its IUPAC name is N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline.
Molecular Properties
| Compound Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline |
| PubChem CID | 5368710 |
| Molecular Formula | C13H10Cl2N2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline |
| SMILES | Clc1ccc(/C=N\Nc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N2/c14-11-7-6-10(13(15)8-11)9-16-17-12-4-2-1-3-5-12/h1-9,17H/b16-9- |
| InChIKey | IWZKRFCQRXJQIZ-SXGWCWSVSA-N |
| XLogP | 4.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline?
The IUPAC name of N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline (CID 5368710) is N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline.
What is the SMILES notation for N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline?
The canonical SMILES for N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline is Clc1ccc(/C=N\Nc2ccccc2)c(Cl)c1.
What is the InChIKey of N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline?
The InChIKey is IWZKRFCQRXJQIZ-SXGWCWSVSA-N. The full InChI is InChI=1S/C13H10Cl2N2/c14-11-7-6-10(13(15)8-11)9-16-17-12-4-2-1-3-5-12/h1-9,17H/b16-9-.
What are the key properties of N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline?
N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline has a molecular weight of 265.14 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(2,4-dichlorophenyl)methylideneamino]aniline is sourced from PubChem (CID 5368710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).