C12H12N4O3 — CID 5368796
5-[(E)-N-anilino-C-methylcarbonimidoyl]-1,3-diazinane-2,4,6-trione (PubChem CID 5368796) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5-[(E)-N-anilino-C-methylcarbonimidoyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-N-anilino-C-methylcarbonimidoyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5368796 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-[(E)-N-anilino-C-methylcarbonimidoyl]-1,3-diazinane-2,4,6-trione |
| SMILES | C/C(=N\Nc1ccccc1)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C12H12N4O3/c1-7(15-16-8-5-3-2-4-6-8)9-10(17)13-12(19)14-11(9)18/h2-6,9,16H,1H3,(H2,13,14,17,18,19)/b15-7+ |
| InChIKey | CLGDLPJJLCZGQX-VIZOYTHASA-N |
| XLogP | 0.46 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|