C35H52O2S — CID 5368800
2-[(3Z,7Z,11E,15Z)-3,7,16,20-tetramethyl-9-phenylsulfanylhenicosa-3,7,11,15,19-pentaenyl]-1,3-dioxane (PubChem CID 5368800) has the molecular formula C35H52O2S and a molecular weight of 536.87 g/mol. Its IUPAC name is 2-[(3Z,7Z,11E,15Z)-3,7,16,20-tetramethyl-9-phenylsulfanylhenicosa-3,7,11,15,19-pentaenyl]-1,3-dioxane.
| Compound Name | 2-[(3Z,7Z,11E,15Z)-3,7,16,20-tetramethyl-9-phenylsulfanylhenicosa-3,7,11,15,19-pentaenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 5368800 |
| Molecular Formula | C35H52O2S |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | 2-[(3Z,7Z,11E,15Z)-3,7,16,20-tetramethyl-9-phenylsulfanylhenicosa-3,7,11,15,19-pentaenyl]-1,3-dioxane |
| SMILES | CC(C)=CCC/C(C)=C\CC/C=C/CC(/C=C(/C)CC/C=C(/C)CCC1OCCCO1)Sc1ccccc1 |
| InChI | InChI=1S/C35H52O2S/c1-29(2)16-13-18-30(3)17-9-6-7-10-23-34(38-33-21-11-8-12-22-33)28-32(5)20-14-19-31(4)24-25-35-36-26-15-27-37-35/h7-8,10-12,16-17,19,21-22,28,34-35H,6,9,13-15,18,20,23-27H2,1-5H3/b10-7+,30-17-,31-19-,32-28- |
| InChIKey | LNEZKQJFBCKEGO-SGPVXXIESA-N |
| XLogP | 10.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|