About N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline
N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline (PubChem CID 5368838) has the molecular formula C17H16N2
and a molecular weight of 248.33 g/mol. Its IUPAC name is N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline.
Molecular Properties
| Compound Name | N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline |
| PubChem CID | 5368838 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline |
| SMILES | C(=C/C=N/c1ccccc1)\C=C\Nc1ccccc1 |
| InChI | InChI=1S/C17H16N2/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17/h1-15,18H/b9-3+,14-8+,19-15+ |
| InChIKey | UDWRJSSBFBSTOO-GLBDIXCZSA-N |
| XLogP | 4.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline?
The IUPAC name of N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline (CID 5368838) is N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline.
What is the SMILES notation for N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline?
The canonical SMILES for N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline is C(=C/C=N/c1ccccc1)\C=C\Nc1ccccc1.
What is the InChIKey of N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline?
The InChIKey is UDWRJSSBFBSTOO-GLBDIXCZSA-N. The full InChI is InChI=1S/C17H16N2/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17/h1-15,18H/b9-3+,14-8+,19-15+.
What are the key properties of N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline?
N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline has a molecular weight of 248.33 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline is sourced from PubChem (CID 5368838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).