C9H12O2S — CID 5368933
(4Z)-3a,6,7,8,9,9a-hexahydrocycloocta[d][1,3]dioxole-2-thione (PubChem CID 5368933) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is (4Z)-3a,6,7,8,9,9a-hexahydrocycloocta[d][1,3]dioxole-2-thione.
| Compound Name | (4Z)-3a,6,7,8,9,9a-hexahydrocycloocta[d][1,3]dioxole-2-thione |
|---|---|
| PubChem CID | 5368933 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (4Z)-3a,6,7,8,9,9a-hexahydrocycloocta[d][1,3]dioxole-2-thione |
| SMILES | S=C1OC2/C=C\CCCCC2O1 |
| InChI | InChI=1S/C9H12O2S/c12-9-10-7-5-3-1-2-4-6-8(7)11-9/h3,5,7-8H,1-2,4,6H2/b5-3- |
| InChIKey | VNYUAYVJJQELKW-HYXAFXHYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|