About (5Z)-2,6-dimethylocta-5,7-dien-4-one
(5Z)-2,6-dimethylocta-5,7-dien-4-one (PubChem CID 5368956) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (5Z)-2,6-dimethylocta-5,7-dien-4-one.
Molecular Properties
| Compound Name | (5Z)-2,6-dimethylocta-5,7-dien-4-one |
| PubChem CID | 5368956 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (5Z)-2,6-dimethylocta-5,7-dien-4-one |
| SMILES | C=C/C(C)=C\C(=O)CC(C)C |
| InChI | InChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5,7-8H,1,6H2,2-4H3/b9-7- |
| InChIKey | RJXKHBTYHGBOKV-CLFYSBASSA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-2,6-dimethylocta-5,7-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-2,6-dimethylocta-5,7-dien-4-one?
The IUPAC name of (5Z)-2,6-dimethylocta-5,7-dien-4-one (CID 5368956) is (5Z)-2,6-dimethylocta-5,7-dien-4-one.
What is the SMILES notation for (5Z)-2,6-dimethylocta-5,7-dien-4-one?
The canonical SMILES for (5Z)-2,6-dimethylocta-5,7-dien-4-one is C=C/C(C)=C\C(=O)CC(C)C.
What is the InChIKey of (5Z)-2,6-dimethylocta-5,7-dien-4-one?
The InChIKey is RJXKHBTYHGBOKV-CLFYSBASSA-N. The full InChI is InChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5,7-8H,1,6H2,2-4H3/b9-7-.
What are the key properties of (5Z)-2,6-dimethylocta-5,7-dien-4-one?
(5Z)-2,6-dimethylocta-5,7-dien-4-one has a molecular weight of 152.24 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-2,6-dimethylocta-5,7-dien-4-one is sourced from PubChem (CID 5368956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).