C12H22O — CID 5368975
(5E)-2,4,4,7-tetramethylocta-5,7-dien-3-ol (PubChem CID 5368975) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (5E)-2,4,4,7-tetramethylocta-5,7-dien-3-ol.
| Compound Name | (5E)-2,4,4,7-tetramethylocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 5368975 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (5E)-2,4,4,7-tetramethylocta-5,7-dien-3-ol |
| SMILES | C=C(C)/C=C/C(C)(C)C(O)C(C)C |
| InChI | InChI=1S/C12H22O/c1-9(2)7-8-12(5,6)11(13)10(3)4/h7-8,10-11,13H,1H2,2-6H3/b8-7+ |
| InChIKey | UMCQKTYQMNTBJK-BQYQJAHWSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|