About (1Z,5Z)-3-tert-butylcycloocta-1,5-diene
(1Z,5Z)-3-tert-butylcycloocta-1,5-diene (PubChem CID 5368978) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is (1Z,5Z)-3-tert-butylcycloocta-1,5-diene.
Molecular Properties
| Compound Name | (1Z,5Z)-3-tert-butylcycloocta-1,5-diene |
| PubChem CID | 5368978 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (1Z,5Z)-3-tert-butylcycloocta-1,5-diene |
| SMILES | CC(C)(C)C1/C=C\CC/C=C\C1 |
| InChI | InChI=1S/C12H20/c1-12(2,3)11-9-7-5-4-6-8-10-11/h5,7-8,10-11H,4,6,9H2,1-3H3/b7-5-,10-8- |
| InChIKey | RUEJAGYMWJNBGK-RRMOSLQNSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,5Z)-3-tert-butylcycloocta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,5Z)-3-tert-butylcycloocta-1,5-diene?
The IUPAC name of (1Z,5Z)-3-tert-butylcycloocta-1,5-diene (CID 5368978) is (1Z,5Z)-3-tert-butylcycloocta-1,5-diene.
What is the SMILES notation for (1Z,5Z)-3-tert-butylcycloocta-1,5-diene?
The canonical SMILES for (1Z,5Z)-3-tert-butylcycloocta-1,5-diene is CC(C)(C)C1/C=C\CC/C=C\C1.
What is the InChIKey of (1Z,5Z)-3-tert-butylcycloocta-1,5-diene?
The InChIKey is RUEJAGYMWJNBGK-RRMOSLQNSA-N. The full InChI is InChI=1S/C12H20/c1-12(2,3)11-9-7-5-4-6-8-10-11/h5,7-8,10-11H,4,6,9H2,1-3H3/b7-5-,10-8-.
What are the key properties of (1Z,5Z)-3-tert-butylcycloocta-1,5-diene?
(1Z,5Z)-3-tert-butylcycloocta-1,5-diene has a molecular weight of 164.29 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,5Z)-3-tert-butylcycloocta-1,5-diene is sourced from PubChem (CID 5368978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).