About (Z)-6,6-diethoxyhex-2-en-4-yne
(Z)-6,6-diethoxyhex-2-en-4-yne (PubChem CID 5368983) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (Z)-6,6-diethoxyhex-2-en-4-yne.
Molecular Properties
| Compound Name | (Z)-6,6-diethoxyhex-2-en-4-yne |
| PubChem CID | 5368983 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (Z)-6,6-diethoxyhex-2-en-4-yne |
| SMILES | C/C=C\C#CC(OCC)OCC |
| InChI | InChI=1S/C10H16O2/c1-4-7-8-9-10(11-5-2)12-6-3/h4,7,10H,5-6H2,1-3H3/b7-4- |
| InChIKey | PWVMDUWRROUKSZ-DAXSKMNVSA-N |
| XLogP | 1.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6,6-diethoxyhex-2-en-4-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6,6-diethoxyhex-2-en-4-yne?
The IUPAC name of (Z)-6,6-diethoxyhex-2-en-4-yne (CID 5368983) is (Z)-6,6-diethoxyhex-2-en-4-yne.
What is the SMILES notation for (Z)-6,6-diethoxyhex-2-en-4-yne?
The canonical SMILES for (Z)-6,6-diethoxyhex-2-en-4-yne is C/C=C\C#CC(OCC)OCC.
What is the InChIKey of (Z)-6,6-diethoxyhex-2-en-4-yne?
The InChIKey is PWVMDUWRROUKSZ-DAXSKMNVSA-N. The full InChI is InChI=1S/C10H16O2/c1-4-7-8-9-10(11-5-2)12-6-3/h4,7,10H,5-6H2,1-3H3/b7-4-.
What are the key properties of (Z)-6,6-diethoxyhex-2-en-4-yne?
(Z)-6,6-diethoxyhex-2-en-4-yne has a molecular weight of 168.24 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6,6-diethoxyhex-2-en-4-yne is sourced from PubChem (CID 5368983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).