About (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine
(E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine (PubChem CID 5369073) has the molecular formula C13H16BrN5
and a molecular weight of 322.21 g/mol. Its IUPAC name is (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine.
Molecular Properties
| Compound Name | (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine |
| PubChem CID | 5369073 |
| Molecular Formula | C13H16BrN5 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine |
| SMILES | CCN(/C=C/c1nnnn1-c1ccc(Br)cc1)CC |
| InChI | InChI=1S/C13H16BrN5/c1-3-18(4-2)10-9-13-15-16-17-19(13)12-7-5-11(14)6-8-12/h5-10H,3-4H2,1-2H3/b10-9+ |
| InChIKey | TXYDLQHXSMWVNN-MDZDMXLPSA-N |
| XLogP | 2.74 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine?
The IUPAC name of (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine (CID 5369073) is (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine.
What is the SMILES notation for (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine?
The canonical SMILES for (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine is CCN(/C=C/c1nnnn1-c1ccc(Br)cc1)CC.
What is the InChIKey of (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine?
The InChIKey is TXYDLQHXSMWVNN-MDZDMXLPSA-N. The full InChI is InChI=1S/C13H16BrN5/c1-3-18(4-2)10-9-13-15-16-17-19(13)12-7-5-11(14)6-8-12/h5-10H,3-4H2,1-2H3/b10-9+.
What are the key properties of (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine?
(E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine has a molecular weight of 322.21 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[1-(4-bromophenyl)tetrazol-5-yl]-N,N-diethylethenamine is sourced from PubChem (CID 5369073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).