About diethyl (2E,4E)-hexa-2,4-dienedioate
diethyl (2E,4E)-hexa-2,4-dienedioate (PubChem CID 5369089) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is diethyl (2E,4E)-hexa-2,4-dienedioate.
Molecular Properties
| Compound Name | diethyl (2E,4E)-hexa-2,4-dienedioate |
| PubChem CID | 5369089 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | diethyl (2E,4E)-hexa-2,4-dienedioate |
| SMILES | CCOC(=O)/C=C/C=C/C(=O)OCC |
| InChI | InChI=1S/C10H14O4/c1-3-13-9(11)7-5-6-8-10(12)14-4-2/h5-8H,3-4H2,1-2H3/b7-5+,8-6+ |
| InChIKey | VHIYCPCXACHVJM-KQQUZDAGSA-N |
| XLogP | 1.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze diethyl (2E,4E)-hexa-2,4-dienedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2E,4E)-hexa-2,4-dienedioate?
The IUPAC name of diethyl (2E,4E)-hexa-2,4-dienedioate (CID 5369089) is diethyl (2E,4E)-hexa-2,4-dienedioate.
What is the SMILES notation for diethyl (2E,4E)-hexa-2,4-dienedioate?
The canonical SMILES for diethyl (2E,4E)-hexa-2,4-dienedioate is CCOC(=O)/C=C/C=C/C(=O)OCC.
What is the InChIKey of diethyl (2E,4E)-hexa-2,4-dienedioate?
The InChIKey is VHIYCPCXACHVJM-KQQUZDAGSA-N. The full InChI is InChI=1S/C10H14O4/c1-3-13-9(11)7-5-6-8-10(12)14-4-2/h5-8H,3-4H2,1-2H3/b7-5+,8-6+.
What are the key properties of diethyl (2E,4E)-hexa-2,4-dienedioate?
diethyl (2E,4E)-hexa-2,4-dienedioate has a molecular weight of 198.22 g/mol, XLogP of 1.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2E,4E)-hexa-2,4-dienedioate is sourced from PubChem (CID 5369089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).