C12H18N2OS — CID 5369107
4-propan-2-yl-2-sulfanylidene-4,4a,5,6,7,8-hexahydro-3H-benzo[e][1,3]oxazine-8a-carbonitrile (PubChem CID 5369107) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 4-propan-2-yl-2-sulfanylidene-4,4a,5,6,7,8-hexahydro-3H-benzo[e][1,3]oxazine-8a-carbonitrile.
| Compound Name | 4-propan-2-yl-2-sulfanylidene-4,4a,5,6,7,8-hexahydro-3H-benzo[e][1,3]oxazine-8a-carbonitrile |
|---|---|
| PubChem CID | 5369107 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-propan-2-yl-2-sulfanylidene-4,4a,5,6,7,8-hexahydro-3H-benzo[e][1,3]oxazine-8a-carbonitrile |
| SMILES | CC(C)C1NC(=S)OC2(C#N)CCCCC12 |
| InChI | InChI=1S/C12H18N2OS/c1-8(2)10-9-5-3-4-6-12(9,7-13)15-11(16)14-10/h8-10H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | VFLGXYHEGPUGEQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|