C21H40N2 — CID 5369151
2-[(Z)-heptadec-5-enyl]-1-methyl-4,5-dihydroimidazole (PubChem CID 5369151) has the molecular formula C21H40N2 and a molecular weight of 320.56 g/mol. Its IUPAC name is 2-[(Z)-heptadec-5-enyl]-1-methyl-4,5-dihydroimidazole.
| Compound Name | 2-[(Z)-heptadec-5-enyl]-1-methyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 5369151 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | 2-[(Z)-heptadec-5-enyl]-1-methyl-4,5-dihydroimidazole |
| SMILES | CCCCCCCCCCC/C=C\CCCCC1=NCCN1C |
| InChI | InChI=1S/C21H40N2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-22-19-20-23(21)2/h13-14H,3-12,15-20H2,1-2H3/b14-13- |
| InChIKey | VGVMSWZDLCHNGX-YPKPFQOOSA-N |
| XLogP | 6.37 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|