About (E)-but-2-enedihydrazide
(E)-but-2-enedihydrazide (PubChem CID 5369154) has the molecular formula C4H8N4O2
and a molecular weight of 144.13 g/mol. Its IUPAC name is (E)-but-2-enedihydrazide.
Molecular Properties
| Compound Name | (E)-but-2-enedihydrazide |
| PubChem CID | 5369154 |
| Molecular Formula | C4H8N4O2 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | (E)-but-2-enedihydrazide |
| SMILES | NNC(=O)/C=C/C(=O)NN |
| InChI | InChI=1S/C4H8N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2H,5-6H2,(H,7,9)(H,8,10)/b2-1+ |
| InChIKey | SNVRDQORMVVQBI-OWOJBTEDSA-N |
| XLogP | -2.48 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedihydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedihydrazide?
The IUPAC name of (E)-but-2-enedihydrazide (CID 5369154) is (E)-but-2-enedihydrazide.
What is the SMILES notation for (E)-but-2-enedihydrazide?
The canonical SMILES for (E)-but-2-enedihydrazide is NNC(=O)/C=C/C(=O)NN.
What is the InChIKey of (E)-but-2-enedihydrazide?
The InChIKey is SNVRDQORMVVQBI-OWOJBTEDSA-N. The full InChI is InChI=1S/C4H8N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2H,5-6H2,(H,7,9)(H,8,10)/b2-1+.
What are the key properties of (E)-but-2-enedihydrazide?
(E)-but-2-enedihydrazide has a molecular weight of 144.13 g/mol, XLogP of -2.48, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedihydrazide is sourced from PubChem (CID 5369154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).