About (4E)-N-butyldeca-4,9-dien-2-amine
(4E)-N-butyldeca-4,9-dien-2-amine (PubChem CID 5369244) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is (4E)-N-butyldeca-4,9-dien-2-amine.
Molecular Properties
| Compound Name | (4E)-N-butyldeca-4,9-dien-2-amine |
| PubChem CID | 5369244 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (4E)-N-butyldeca-4,9-dien-2-amine |
| SMILES | C=CCCC/C=C/CC(C)NCCCC |
| InChI | InChI=1S/C14H27N/c1-4-6-8-9-10-11-12-14(3)15-13-7-5-2/h4,10-11,14-15H,1,5-9,12-13H2,2-3H3/b11-10+ |
| InChIKey | MKVOGFCGDWJDOY-ZHACJKMWSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-N-butyldeca-4,9-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-N-butyldeca-4,9-dien-2-amine?
The IUPAC name of (4E)-N-butyldeca-4,9-dien-2-amine (CID 5369244) is (4E)-N-butyldeca-4,9-dien-2-amine.
What is the SMILES notation for (4E)-N-butyldeca-4,9-dien-2-amine?
The canonical SMILES for (4E)-N-butyldeca-4,9-dien-2-amine is C=CCCC/C=C/CC(C)NCCCC.
What is the InChIKey of (4E)-N-butyldeca-4,9-dien-2-amine?
The InChIKey is MKVOGFCGDWJDOY-ZHACJKMWSA-N. The full InChI is InChI=1S/C14H27N/c1-4-6-8-9-10-11-12-14(3)15-13-7-5-2/h4,10-11,14-15H,1,5-9,12-13H2,2-3H3/b11-10+.
What are the key properties of (4E)-N-butyldeca-4,9-dien-2-amine?
(4E)-N-butyldeca-4,9-dien-2-amine has a molecular weight of 209.38 g/mol, XLogP of 4.07, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-N-butyldeca-4,9-dien-2-amine is sourced from PubChem (CID 5369244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).