C14H25N — CID 5369245
(4E,7E)-N-butyldeca-4,7,9-trien-2-amine (PubChem CID 5369245) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (4E,7E)-N-butyldeca-4,7,9-trien-2-amine.
| Compound Name | (4E,7E)-N-butyldeca-4,7,9-trien-2-amine |
|---|---|
| PubChem CID | 5369245 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (4E,7E)-N-butyldeca-4,7,9-trien-2-amine |
| SMILES | C=C/C=C/C/C=C/CC(C)NCCCC |
| InChI | InChI=1S/C14H25N/c1-4-6-8-9-10-11-12-14(3)15-13-7-5-2/h4,6,8,10-11,14-15H,1,5,7,9,12-13H2,2-3H3/b8-6+,11-10+ |
| InChIKey | JEAJDIWSQBQTHU-UMYLGFLZSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|