C15H22O3 — CID 5369324
methyl (2E)-2-[(5E,9E)-5,9-dimethyl-1-oxacycloundeca-5,9-dien-2-ylidene]acetate (PubChem CID 5369324) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl (2E)-2-[(5E,9E)-5,9-dimethyl-1-oxacycloundeca-5,9-dien-2-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(5E,9E)-5,9-dimethyl-1-oxacycloundeca-5,9-dien-2-ylidene]acetate |
|---|---|
| PubChem CID | 5369324 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | methyl (2E)-2-[(5E,9E)-5,9-dimethyl-1-oxacycloundeca-5,9-dien-2-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CC/C(C)=C/CC/C(C)=C/CO1 |
| InChI | InChI=1S/C15H22O3/c1-12-5-4-6-13(2)9-10-18-14(8-7-12)11-15(16)17-3/h5,9,11H,4,6-8,10H2,1-3H3/b12-5+,13-9+,14-11+ |
| InChIKey | QIVLYIYYOHIOEV-UYKKJPEZSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|