C9H11F7O2 — CID 536950
3-methylbutyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 536950) has the molecular formula C9H11F7O2 and a molecular weight of 284.17 g/mol. Its IUPAC name is 3-methylbutyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 3-methylbutyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 536950 |
| Molecular Formula | C9H11F7O2 |
| Molecular Weight | 284.17 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-methylbutyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(C)CCOC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F7O2/c1-5(2)3-4-18-6(17)7(10,11)8(12,13)9(14,15)16/h5H,3-4H2,1-2H3 |
| InChIKey | AHKCGBGVCKMGEE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|