About (E)-1,4-diphenylbut-3-en-1-one
(E)-1,4-diphenylbut-3-en-1-one (PubChem CID 5369654) has the molecular formula C16H14O
and a molecular weight of 222.29 g/mol. Its IUPAC name is (E)-1,4-diphenylbut-3-en-1-one.
Molecular Properties
| Compound Name | (E)-1,4-diphenylbut-3-en-1-one |
| PubChem CID | 5369654 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (E)-1,4-diphenylbut-3-en-1-one |
| SMILES | O=C(C/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14O/c17-16(15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h1-12H,13H2/b10-7+ |
| InChIKey | GBUFRJCGZJNUSB-JXMROGBWSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-1,4-diphenylbut-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,4-diphenylbut-3-en-1-one?
The IUPAC name of (E)-1,4-diphenylbut-3-en-1-one (CID 5369654) is (E)-1,4-diphenylbut-3-en-1-one.
What is the SMILES notation for (E)-1,4-diphenylbut-3-en-1-one?
The canonical SMILES for (E)-1,4-diphenylbut-3-en-1-one is O=C(C/C=C/c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-1,4-diphenylbut-3-en-1-one?
The InChIKey is GBUFRJCGZJNUSB-JXMROGBWSA-N. The full InChI is InChI=1S/C16H14O/c17-16(15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h1-12H,13H2/b10-7+.
What are the key properties of (E)-1,4-diphenylbut-3-en-1-one?
(E)-1,4-diphenylbut-3-en-1-one has a molecular weight of 222.29 g/mol, XLogP of 3.97, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,4-diphenylbut-3-en-1-one is sourced from PubChem (CID 5369654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).