C19H20O — CID 5369755
(E)-1,7-diphenylhept-6-en-1-one (PubChem CID 5369755) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is (E)-1,7-diphenylhept-6-en-1-one.
| Compound Name | (E)-1,7-diphenylhept-6-en-1-one |
|---|---|
| PubChem CID | 5369755 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (E)-1,7-diphenylhept-6-en-1-one |
| SMILES | O=C(CCCC/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O/c20-19(18-14-8-4-9-15-18)16-10-2-1-5-11-17-12-6-3-7-13-17/h3-9,11-15H,1-2,10,16H2/b11-5+ |
| InChIKey | MBRJIENVTFUILU-VZUCSPMQSA-N |
| XLogP | 5.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|