C15H22O — CID 5369926
4,6,6-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]-3-oxatricyclo[5.1.0.02,4]octane (PubChem CID 5369926) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 4,6,6-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]-3-oxatricyclo[5.1.0.02,4]octane.
| Compound Name | 4,6,6-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]-3-oxatricyclo[5.1.0.02,4]octane |
|---|---|
| PubChem CID | 5369926 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 4,6,6-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]-3-oxatricyclo[5.1.0.02,4]octane |
| SMILES | C=C(C)/C=C/C12OC1(C)CC(C)(C)C1CC12 |
| InChI | InChI=1S/C15H22O/c1-10(2)6-7-15-12-8-11(12)13(3,4)9-14(15,5)16-15/h6-7,11-12H,1,8-9H2,2-5H3/b7-6+ |
| InChIKey | JEWBTTPLZBTNTA-VOTSOKGWSA-N |
| XLogP | 3.71 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|