C29H40O6S — CID 5369991
dimethyl (2E,6E,10E)-13-(benzenesulfonyl)-3,7,11-trimethyl-13-(2-methylprop-1-enyl)tetradeca-2,6,10-trienedioate (PubChem CID 5369991) has the molecular formula C29H40O6S and a molecular weight of 516.70 g/mol. Its IUPAC name is dimethyl (2E,6E,10E)-13-(benzenesulfonyl)-3,7,11-trimethyl-13-(2-methylprop-1-enyl)tetradeca-2,6,10-trienedioate.
| Compound Name | dimethyl (2E,6E,10E)-13-(benzenesulfonyl)-3,7,11-trimethyl-13-(2-methylprop-1-enyl)tetradeca-2,6,10-trienedioate |
|---|---|
| PubChem CID | 5369991 |
| Molecular Formula | C29H40O6S |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | dimethyl (2E,6E,10E)-13-(benzenesulfonyl)-3,7,11-trimethyl-13-(2-methylprop-1-enyl)tetradeca-2,6,10-trienedioate |
| SMILES | COC(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC(C=C(C)C)(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H40O6S/c1-22(2)20-29(28(31)35-7,36(32,33)26-17-9-8-10-18-26)21-25(5)16-12-14-23(3)13-11-15-24(4)19-27(30)34-6/h8-10,13,16-20H,11-12,14-15,21H2,1-7H3/b23-13+,24-19+,25-16+ |
| InChIKey | IKGMUTZNRPGNHF-ISJGFOTJSA-N |
| XLogP | 6.30 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|