C16H24O6 — CID 5370005
trimethyl (3E,7E)-3,7-dimethylocta-3,7-diene-1,1,8-tricarboxylate (PubChem CID 5370005) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is trimethyl (3E,7E)-3,7-dimethylocta-3,7-diene-1,1,8-tricarboxylate.
| Compound Name | trimethyl (3E,7E)-3,7-dimethylocta-3,7-diene-1,1,8-tricarboxylate |
|---|---|
| PubChem CID | 5370005 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | trimethyl (3E,7E)-3,7-dimethylocta-3,7-diene-1,1,8-tricarboxylate |
| SMILES | COC(=O)/C=C(\C)CC/C=C(\C)CC(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H24O6/c1-11(7-6-8-12(2)10-14(17)20-3)9-13(15(18)21-4)16(19)22-5/h7,10,13H,6,8-9H2,1-5H3/b11-7+,12-10+ |
| InChIKey | HFWJLWSJLPMACS-CRALUGIISA-N |
| XLogP | 2.18 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|