About (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol
(4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol (PubChem CID 5370028) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol.
Molecular Properties
| Compound Name | (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol |
| PubChem CID | 5370028 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol |
| SMILES | C=C1C=CCC(C)(C)/C1=C(\C)CC(C)O |
| InChI | InChI=1S/C14H22O/c1-10-7-6-8-14(4,5)13(10)11(2)9-12(3)15/h6-7,12,15H,1,8-9H2,2-5H3/b13-11+ |
| InChIKey | MCGCKEDQRQRYTC-ACCUITESSA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol?
The IUPAC name of (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol (CID 5370028) is (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol.
What is the SMILES notation for (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol?
The canonical SMILES for (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol is C=C1C=CCC(C)(C)/C1=C(\C)CC(C)O.
What is the InChIKey of (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol?
The InChIKey is MCGCKEDQRQRYTC-ACCUITESSA-N. The full InChI is InChI=1S/C14H22O/c1-10-7-6-8-14(4,5)13(10)11(2)9-12(3)15/h6-7,12,15H,1,8-9H2,2-5H3/b13-11+.
What are the key properties of (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol?
(4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol has a molecular weight of 206.33 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(6,6-dimethyl-2-methylidenecyclohex-3-en-1-ylidene)pentan-2-ol is sourced from PubChem (CID 5370028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).