C14H24O — CID 5370099
1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol (PubChem CID 5370099) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol.
| Compound Name | 1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 5370099 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol |
| SMILES | C=C(C)/C=C/C1C(C)(C)CCCC1(C)O |
| InChI | InChI=1S/C14H24O/c1-11(2)7-8-12-13(3,4)9-6-10-14(12,5)15/h7-8,12,15H,1,6,9-10H2,2-5H3/b8-7+ |
| InChIKey | XZPYVODRIRKFJE-BQYQJAHWSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|