C9H16 — CID 5370116
2,4-Heptadiene, 2,4-dimethyl- (PubChem CID 5370116) has the molecular formula C9H16 and a molecular weight of 124.22 g/mol. Its IUPAC name is (4E)-2,4-dimethylhepta-2,4-diene.
| Compound Name | 2,4-Heptadiene, 2,4-dimethyl- |
|---|---|
| PubChem CID | 5370116 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.22 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (4E)-2,4-dimethylhepta-2,4-diene |
| SMILES | CC/C=C(\C)/C=C(C)C |
| InChI | InChI=1S/C9H16/c1-5-6-9(4)7-8(2)3/h6-7H,5H2,1-4H3/b9-6+ |
| InChIKey | FFLHUMMPCUSQSJ-RMKNXTFCSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | 123 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|