About (5E)-6,10-dimethylundeca-5,9-dien-2-ol
(5E)-6,10-dimethylundeca-5,9-dien-2-ol (PubChem CID 5370125) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is (5E)-6,10-dimethylundeca-5,9-dien-2-ol.
Molecular Properties
| Compound Name | (5E)-6,10-dimethylundeca-5,9-dien-2-ol |
| PubChem CID | 5370125 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (5E)-6,10-dimethylundeca-5,9-dien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)O |
| InChI | InChI=1S/C13H24O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h7,9,13-14H,5-6,8,10H2,1-4H3/b12-9+ |
| InChIKey | LYFDNQZGOHRKNK-FMIVXFBMSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-6,10-dimethylundeca-5,9-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-6,10-dimethylundeca-5,9-dien-2-ol?
The IUPAC name of (5E)-6,10-dimethylundeca-5,9-dien-2-ol (CID 5370125) is (5E)-6,10-dimethylundeca-5,9-dien-2-ol.
What is the SMILES notation for (5E)-6,10-dimethylundeca-5,9-dien-2-ol?
The canonical SMILES for (5E)-6,10-dimethylundeca-5,9-dien-2-ol is CC(C)=CCC/C(C)=C/CCC(C)O.
What is the InChIKey of (5E)-6,10-dimethylundeca-5,9-dien-2-ol?
The InChIKey is LYFDNQZGOHRKNK-FMIVXFBMSA-N. The full InChI is InChI=1S/C13H24O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h7,9,13-14H,5-6,8,10H2,1-4H3/b12-9+.
What are the key properties of (5E)-6,10-dimethylundeca-5,9-dien-2-ol?
(5E)-6,10-dimethylundeca-5,9-dien-2-ol has a molecular weight of 196.33 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-6,10-dimethylundeca-5,9-dien-2-ol is sourced from PubChem (CID 5370125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).