C12H20N2 — CID 5370127
(E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)prop-2-enenitrile (PubChem CID 5370127) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5370127 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)prop-2-enenitrile |
| SMILES | CC1(C)CCCC(C)(C)N1/C=C/C#N |
| InChI | InChI=1S/C12H20N2/c1-11(2)7-5-8-12(3,4)14(11)10-6-9-13/h6,10H,5,7-8H2,1-4H3/b10-6+ |
| InChIKey | JJUJKPYAFZGQBX-UXBLZVDNSA-N |
| XLogP | 3.07 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|