C13H24 — CID 5370147
(E)-2,2,3,6,6-pentamethyl-5-methylidenehept-3-ene (PubChem CID 5370147) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (E)-2,2,3,6,6-pentamethyl-5-methylidenehept-3-ene.
| Compound Name | (E)-2,2,3,6,6-pentamethyl-5-methylidenehept-3-ene |
|---|---|
| PubChem CID | 5370147 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (E)-2,2,3,6,6-pentamethyl-5-methylidenehept-3-ene |
| SMILES | C=C(/C=C(\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H24/c1-10(12(3,4)5)9-11(2)13(6,7)8/h9H,1H2,2-8H3/b11-9+ |
| InChIKey | RTSPCUSBLOXPSI-PKNBQFBNSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|