C17H21NO2 — CID 5370189
1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienyl]piperidine (PubChem CID 5370189) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienyl]piperidine.
| Compound Name | 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienyl]piperidine |
|---|---|
| PubChem CID | 5370189 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienyl]piperidine |
| SMILES | C(/C=C/c1ccc2c(c1)OCO2)=C\CN1CCCCC1 |
| InChI | InChI=1S/C17H21NO2/c1(4-10-18-11-5-2-6-12-18)3-7-15-8-9-16-17(13-15)20-14-19-16/h1,3-4,7-9,13H,2,5-6,10-12,14H2/b4-1+,7-3+ |
| InChIKey | WSPMSRHCKZFXOA-YYPVUZKKSA-N |
| XLogP | 3.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|