About (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one
(7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one (PubChem CID 5370371) has the molecular formula C20H35NO
and a molecular weight of 305.51 g/mol. Its IUPAC name is (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one.
Molecular Properties
| Compound Name | (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one |
| PubChem CID | 5370371 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one |
| SMILES | CCCCC/C=C/C/C=C/CCCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C20H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20(22)21-18-15-16-19-21/h6-7,9-10H,2-5,8,11-19H2,1H3/b7-6+,10-9+ |
| InChIKey | ZVYZOSDILQDZJD-AVQMFFATSA-N |
| XLogP | 5.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one?
The IUPAC name of (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one (CID 5370371) is (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one.
What is the SMILES notation for (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one?
The canonical SMILES for (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one is CCCCC/C=C/C/C=C/CCCCCC(=O)N1CCCC1.
What is the InChIKey of (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one?
The InChIKey is ZVYZOSDILQDZJD-AVQMFFATSA-N. The full InChI is InChI=1S/C20H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20(22)21-18-15-16-19-21/h6-7,9-10H,2-5,8,11-19H2,1H3/b7-6+,10-9+.
What are the key properties of (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one?
(7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one has a molecular weight of 305.51 g/mol, XLogP of 5.64, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7E,10E)-1-pyrrolidin-1-ylhexadeca-7,10-dien-1-one is sourced from PubChem (CID 5370371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).