C10H9N3S2 — CID 5370709
4-methyl-6-phenyl-2H-1,2,4-triazine-3,5-dithione (PubChem CID 5370709) has the molecular formula C10H9N3S2 and a molecular weight of 235.34 g/mol. Its IUPAC name is 4-methyl-6-phenyl-2H-1,2,4-triazine-3,5-dithione.
| Compound Name | 4-methyl-6-phenyl-2H-1,2,4-triazine-3,5-dithione |
|---|---|
| PubChem CID | 5370709 |
| Molecular Formula | C10H9N3S2 |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 4-methyl-6-phenyl-2H-1,2,4-triazine-3,5-dithione |
| SMILES | Cn1c(=S)[nH]nc(-c2ccccc2)c1=S |
| InChI | InChI=1S/C10H9N3S2/c1-13-9(14)8(11-12-10(13)15)7-5-3-2-4-6-7/h2-6H,1H3,(H,12,15) |
| InChIKey | INZMPTVHJKRIOB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|