About 5H-pyrrolo[2,3-b]pyrazine
5H-pyrrolo[2,3-b]pyrazine (PubChem CID 5370803) has the molecular formula C6H5N3
and a molecular weight of 119.13 g/mol. Its IUPAC name is 5H-pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 5H-pyrrolo[2,3-b]pyrazine |
| PubChem CID | 5370803 |
| Molecular Formula | C6H5N3 |
| Molecular Weight | 119.13 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | 5H-pyrrolo[2,3-b]pyrazine |
| SMILES | c1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C6H5N3/c1-2-8-6-5(1)7-3-4-9-6/h1-4H,(H,8,9) |
| InChIKey | HFTVJMFWJUFBNO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.13 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[2,3-b]pyrazine?
The IUPAC name of 5H-pyrrolo[2,3-b]pyrazine (CID 5370803) is 5H-pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 5H-pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 5H-pyrrolo[2,3-b]pyrazine is c1cnc2[nH]ccc2n1.
What is the InChIKey of 5H-pyrrolo[2,3-b]pyrazine?
The InChIKey is HFTVJMFWJUFBNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3/c1-2-8-6-5(1)7-3-4-9-6/h1-4H,(H,8,9).
What are the key properties of 5H-pyrrolo[2,3-b]pyrazine?
5H-pyrrolo[2,3-b]pyrazine has a molecular weight of 119.13 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 5370803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).