C14H13N3O — CID 5370943
N-[(Z)-benzylideneamino]-6-methylpyridine-3-carboxamide (PubChem CID 5370943) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is N-[(Z)-benzylideneamino]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[(Z)-benzylideneamino]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 5370943 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-[(Z)-benzylideneamino]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N/N=C\c2ccccc2)cn1 |
| InChI | InChI=1S/C14H13N3O/c1-11-7-8-13(10-15-11)14(18)17-16-9-12-5-3-2-4-6-12/h2-10H,1H3,(H,17,18)/b16-9- |
| InChIKey | ZIDWWZFZQGNJTH-SXGWCWSVSA-N |
| XLogP | 2.15 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|