C14H24O2 — CID 5371280
1-(hydroxymethyl)-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol (PubChem CID 5371280) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 1-(hydroxymethyl)-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol.
| Compound Name | 1-(hydroxymethyl)-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 5371280 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1-(hydroxymethyl)-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol |
| SMILES | C=C(C)/C=C/C1C(C)(C)CCCC1(O)CO |
| InChI | InChI=1S/C14H24O2/c1-11(2)6-7-12-13(3,4)8-5-9-14(12,16)10-15/h6-7,12,15-16H,1,5,8-10H2,2-4H3/b7-6+ |
| InChIKey | QPVYRMFKHHDMTP-VOTSOKGWSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|