About (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one
(1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one (PubChem CID 5371369) has the molecular formula C15H9Cl2NO2S
and a molecular weight of 338.22 g/mol. Its IUPAC name is (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one.
Molecular Properties
| Compound Name | (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
| PubChem CID | 5371369 |
| Molecular Formula | C15H9Cl2NO2S |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
| SMILES | Cc1cc2c(c(=S)[nH]1)C(=O)O/C2=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2NO2S/c1-7-4-9-12(20-15(19)13(9)14(21)18-7)6-8-2-3-10(16)11(17)5-8/h2-6H,1H3,(H,18,21)/b12-6+ |
| InChIKey | DOFZPOGIYUVLDR-WUXMJOGZSA-N |
| XLogP | 5.03 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_J(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one?
The IUPAC name of (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one (CID 5371369) is (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one.
What is the SMILES notation for (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one?
The canonical SMILES for (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one is Cc1cc2c(c(=S)[nH]1)C(=O)O/C2=C/c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one?
The InChIKey is DOFZPOGIYUVLDR-WUXMJOGZSA-N. The full InChI is InChI=1S/C15H9Cl2NO2S/c1-7-4-9-12(20-15(19)13(9)14(21)18-7)6-8-2-3-10(16)11(17)5-8/h2-6H,1H3,(H,18,21)/b12-6+.
What are the key properties of (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one?
(1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one has a molecular weight of 338.22 g/mol, XLogP of 5.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one is sourced from PubChem (CID 5371369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).