About N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide
N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide (PubChem CID 5371536) has the molecular formula C12H11N5O5
and a molecular weight of 305.25 g/mol. Its IUPAC name is N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide |
| PubChem CID | 5371536 |
| Molecular Formula | C12H11N5O5 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide |
| SMILES | CC(=O)Nc1nc(=O)c(/C=C/c2ccc([N+](=O)[O-])o2)nn1C |
| InChI | InChI=1S/C12H11N5O5/c1-7(18)13-12-14-11(19)9(15-16(12)2)5-3-8-4-6-10(22-8)17(20)21/h3-6H,1-2H3,(H,13,14,18,19)/b5-3+ |
| InChIKey | TZXFULFPIGWCEQ-HWKANZROSA-N |
| XLogP | 0.81 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide?
The IUPAC name of N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide (CID 5371536) is N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide.
What is the SMILES notation for N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide?
The canonical SMILES for N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide is CC(=O)Nc1nc(=O)c(/C=C/c2ccc([N+](=O)[O-])o2)nn1C.
What is the InChIKey of N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide?
The InChIKey is TZXFULFPIGWCEQ-HWKANZROSA-N. The full InChI is InChI=1S/C12H11N5O5/c1-7(18)13-12-14-11(19)9(15-16(12)2)5-3-8-4-6-10(22-8)17(20)21/h3-6H,1-2H3,(H,13,14,18,19)/b5-3+.
What are the key properties of N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide?
N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide has a molecular weight of 305.25 g/mol, XLogP of 0.81, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methyl-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-5-oxo-1,2,4-triazin-3-yl]acetamide is sourced from PubChem (CID 5371536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).