C20H24Cl2N10 — CID 5371549
View drug profile → picloxydine1-N',4-N'-bis[N'-(4-chlorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide (PubChem CID 5371549) has the molecular formula C20H24Cl2N10 and a molecular weight of 475.39 g/mol. Its IUPAC name is 1-N',4-N'-bis[N'-(4-chlorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide.
| Compound Name | 1-N',4-N'-bis[N'-(4-chlorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide |
|---|---|
| PubChem CID | 5371549 |
| Molecular Formula | C20H24Cl2N10 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 1-N',4-N'-bis[N'-(4-chlorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide |
| SMILES | N/C(=N/C(N)=N/c1ccc(Cl)cc1)N1CCN(/C(N)=N\C(N)=N\c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H24Cl2N10/c21-13-1-5-15(6-2-13)27-17(23)29-19(25)31-9-11-32(12-10-31)20(26)30-18(24)28-16-7-3-14(22)4-8-16/h1-8H,9-12H2,(H4,23,25,27,29)(H4,24,26,28,30) |
| InChIKey | YNCLPFSAZFGQCD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|