C13H27BO2Si — CID 5371620
(3E)-4,5-diethyl-2,2,3,7,8-pentamethyl-7,8-dihydro-1,6,2,5-dioxasilaborocine (PubChem CID 5371620) has the molecular formula C13H27BO2Si and a molecular weight of 254.25 g/mol. Its IUPAC name is (3E)-4,5-diethyl-2,2,3,7,8-pentamethyl-7,8-dihydro-1,6,2,5-dioxasilaborocine.
| Compound Name | (3E)-4,5-diethyl-2,2,3,7,8-pentamethyl-7,8-dihydro-1,6,2,5-dioxasilaborocine |
|---|---|
| PubChem CID | 5371620 |
| Molecular Formula | C13H27BO2Si |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (3E)-4,5-diethyl-2,2,3,7,8-pentamethyl-7,8-dihydro-1,6,2,5-dioxasilaborocine |
| SMILES | CCB1OC(C)C(C)O[Si](C)(C)/C(C)=C\1CC |
| InChI | InChI=1S/C13H27BO2Si/c1-8-13-12(5)17(6,7)16-11(4)10(3)15-14(13)9-2/h10-11H,8-9H2,1-7H3/b13-12- |
| InChIKey | ASEFMPBFDVUQPM-SEYXRHQNSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|