About 1-Methoxy-3-methylbuta-1,3-diene
1-Methoxy-3-methylbuta-1,3-diene (PubChem CID 53717135) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is 1-methoxy-3-methylbuta-1,3-diene.
Molecular Properties
| Compound Name | 1-Methoxy-3-methylbuta-1,3-diene |
| PubChem CID | 53717135 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | 1-methoxy-3-methylbuta-1,3-diene |
| SMILES | CC(=C)C=COC |
| InChI | InChI=1S/C6H10O/c1-6(2)4-5-7-3/h4-5H,1H2,2-3H3 |
| InChIKey | CEQACJSYZXQWRM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | 82 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-Methoxy-3-methylbuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Methoxy-3-methylbuta-1,3-diene?
The IUPAC name of 1-Methoxy-3-methylbuta-1,3-diene (CID 53717135) is 1-methoxy-3-methylbuta-1,3-diene.
What is the SMILES notation for 1-Methoxy-3-methylbuta-1,3-diene?
The canonical SMILES for 1-Methoxy-3-methylbuta-1,3-diene is CC(=C)C=COC.
What is the InChIKey of 1-Methoxy-3-methylbuta-1,3-diene?
The InChIKey is CEQACJSYZXQWRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O/c1-6(2)4-5-7-3/h4-5H,1H2,2-3H3.
What are the key properties of 1-Methoxy-3-methylbuta-1,3-diene?
1-Methoxy-3-methylbuta-1,3-diene has a molecular weight of 98.14 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Methoxy-3-methylbuta-1,3-diene is sourced from PubChem (CID 53717135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).