C36H68O3Si3 — CID 5371828
[(3Z)-3-[(2E)-2-[7a-methyl-1-[6-methyl-1,6-bis(trimethylsilyloxy)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl]oxy-trimethylsilane (PubChem CID 5371828) has the molecular formula C36H68O3Si3 and a molecular weight of 633.20 g/mol. Its IUPAC name is [(3Z)-3-[(2E)-2-[7a-methyl-1-[6-methyl-1,6-bis(trimethylsilyloxy)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl]oxy-trimethylsilane.
| Compound Name | [(3Z)-3-[(2E)-2-[7a-methyl-1-[6-methyl-1,6-bis(trimethylsilyloxy)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 5371828 |
| Molecular Formula | C36H68O3Si3 |
| Molecular Weight | 633.20 g/mol |
| Exact Mass | 632.45 |
| IUPAC Name | [(3Z)-3-[(2E)-2-[7a-methyl-1-[6-methyl-1,6-bis(trimethylsilyloxy)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl]oxy-trimethylsilane |
| SMILES | C=C1CCC(O[Si](C)(C)C)C/C1=C/C=C1\CCCC2(C)C1CCC2C(CCCC(C)(C)O[Si](C)(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C36H68O3Si3/c1-28-18-21-32(38-41(8,9)10)26-30(28)20-19-29-16-15-25-36(4)33(29)22-23-34(36)31(27-37-40(5,6)7)17-14-24-35(2,3)39-42(11,12)13/h19-20,31-34H,1,14-18,21-27H2,2-13H3/b29-19+,30-20- |
| InChIKey | TZUKIDRDIKEQCR-ANMKTWKASA-N |
| XLogP | 11.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.20 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|