C12H16N2 — CID 5371973
2-[[(2E,4E)-3,7-dimethylocta-2,4,6-trienylidene]amino]acetonitrile (PubChem CID 5371973) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-[[(2E,4E)-3,7-dimethylocta-2,4,6-trienylidene]amino]acetonitrile.
| Compound Name | 2-[[(2E,4E)-3,7-dimethylocta-2,4,6-trienylidene]amino]acetonitrile |
|---|---|
| PubChem CID | 5371973 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-[[(2E,4E)-3,7-dimethylocta-2,4,6-trienylidene]amino]acetonitrile |
| SMILES | CC(C)=C/C=C/C(C)=C/C=N/CC#N |
| InChI | InChI=1S/C12H16N2/c1-11(2)5-4-6-12(3)7-9-14-10-8-13/h4-7,9H,10H2,1-3H3/b6-4+,12-7+,14-9+ |
| InChIKey | BLOOGDAYLFNFQK-QTLCHLNDSA-N |
| XLogP | 3.05 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|