About [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate
[(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate (PubChem CID 5372069) has the molecular formula C12H19ClO2
and a molecular weight of 230.73 g/mol. Its IUPAC name is [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate.
Molecular Properties
| Compound Name | [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate |
| PubChem CID | 5372069 |
| Molecular Formula | C12H19ClO2 |
| Molecular Weight | 230.73 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate |
| SMILES | C=C(C)C(Cl)CC/C(C)=C\COC(C)=O |
| InChI | InChI=1S/C12H19ClO2/c1-9(2)12(13)6-5-10(3)7-8-15-11(4)14/h7,12H,1,5-6,8H2,2-4H3/b10-7- |
| InChIKey | WPMFOBQJRQAIKY-YFHOEESVSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate?
The IUPAC name of [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate (CID 5372069) is [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate.
What is the SMILES notation for [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate?
The canonical SMILES for [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate is C=C(C)C(Cl)CC/C(C)=C\COC(C)=O.
What is the InChIKey of [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate?
The InChIKey is WPMFOBQJRQAIKY-YFHOEESVSA-N. The full InChI is InChI=1S/C12H19ClO2/c1-9(2)12(13)6-5-10(3)7-8-15-11(4)14/h7,12H,1,5-6,8H2,2-4H3/b10-7-.
What are the key properties of [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate?
[(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate has a molecular weight of 230.73 g/mol, XLogP of 3.46, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-6-chloro-3,7-dimethylocta-2,7-dienyl] acetate is sourced from PubChem (CID 5372069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).