About 2-aminocyclohepta-2,4,6-triene-1-thione
2-aminocyclohepta-2,4,6-triene-1-thione (PubChem CID 5372360) has the molecular formula C7H7NS
and a molecular weight of 137.21 g/mol. Its IUPAC name is 2-aminocyclohepta-2,4,6-triene-1-thione.
Molecular Properties
| Compound Name | 2-aminocyclohepta-2,4,6-triene-1-thione |
| PubChem CID | 5372360 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 2-aminocyclohepta-2,4,6-triene-1-thione |
| SMILES | Nc1cccccc1=S |
| InChI | InChI=1S/C7H7NS/c8-6-4-2-1-3-5-7(6)9/h1-5H,(H2,8,9) |
| InChIKey | PPLLQJLYBBNMOD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-aminocyclohepta-2,4,6-triene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminocyclohepta-2,4,6-triene-1-thione?
The IUPAC name of 2-aminocyclohepta-2,4,6-triene-1-thione (CID 5372360) is 2-aminocyclohepta-2,4,6-triene-1-thione.
What is the SMILES notation for 2-aminocyclohepta-2,4,6-triene-1-thione?
The canonical SMILES for 2-aminocyclohepta-2,4,6-triene-1-thione is Nc1cccccc1=S.
What is the InChIKey of 2-aminocyclohepta-2,4,6-triene-1-thione?
The InChIKey is PPLLQJLYBBNMOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS/c8-6-4-2-1-3-5-7(6)9/h1-5H,(H2,8,9).
What are the key properties of 2-aminocyclohepta-2,4,6-triene-1-thione?
2-aminocyclohepta-2,4,6-triene-1-thione has a molecular weight of 137.21 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminocyclohepta-2,4,6-triene-1-thione is sourced from PubChem (CID 5372360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).