C24H40O4 — CID 5372421
Menthol, fumarate (2:1), (1R,3R,4S)- (PubChem CID 5372421) has the molecular formula C24H40O4 and a molecular weight of 392.60 g/mol. Its IUPAC name is bis(5-methyl-2-propan-2-ylcyclohexyl) (E)-but-2-enedioate.
| Compound Name | Menthol, fumarate (2:1), (1R,3R,4S)- |
|---|---|
| PubChem CID | 5372421 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | bis(5-methyl-2-propan-2-ylcyclohexyl) (E)-but-2-enedioate |
| SMILES | CC1CCC(C(C1)OC(=O)/C=C/C(=O)OC2CC(CCC2C(C)C)C)C(C)C |
| InChI | InChI=1S/C24H40O4/c1-15(2)19-9-7-17(5)13-21(19)27-23(25)11-12-24(26)28-22-14-18(6)8-10-20(22)16(3)4/h11-12,15-22H,7-10,13-14H2,1-6H3/b12-11+ |
| InChIKey | HTJZKHLYRXPLLS-VAWYXSNFSA-N |
| XLogP | 7.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | 503 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|