C19H31NO3 — CID 5372614
[(2E,4Z,8E)-10-(2-methylpropylamino)-10-oxodeca-2,4,8-trienyl] 3-methylbutanoate (PubChem CID 5372614) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is [(2E,4Z,8E)-10-(2-methylpropylamino)-10-oxodeca-2,4,8-trienyl] 3-methylbutanoate.
| Compound Name | [(2E,4Z,8E)-10-(2-methylpropylamino)-10-oxodeca-2,4,8-trienyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 5372614 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | [(2E,4Z,8E)-10-(2-methylpropylamino)-10-oxodeca-2,4,8-trienyl] 3-methylbutanoate |
| SMILES | CC(C)CNC(=O)/C=C/CC/C=C\C=C\COC(=O)CC(C)C |
| InChI | InChI=1S/C19H31NO3/c1-16(2)14-19(22)23-13-11-9-7-5-6-8-10-12-18(21)20-15-17(3)4/h5,7,9-12,16-17H,6,8,13-15H2,1-4H3,(H,20,21)/b7-5-,11-9+,12-10+ |
| InChIKey | KQNWUWPQQLFYFQ-CJKQPOKFSA-N |
| XLogP | 3.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|